C24H21ClFNO7S — CID 10165018
3-[3-chloro-4-[3-[(4-fluorophenyl)methylsulfonyl]-4-hydroxyphenoxy]-5-methylanilino]-2-methyl-3-oxopropanoic acid (PubChem CID 10165018) has the molecular formula C24H21ClFNO7S and a molecular weight of 521.95 g/mol. Its IUPAC name is 3-[3-chloro-4-[3-[(4-fluorophenyl)methylsulfonyl]-4-hydroxyphenoxy]-5-methylanilino]-2-methyl-3-oxopropanoic acid.
| Compound Name | 3-[3-chloro-4-[3-[(4-fluorophenyl)methylsulfonyl]-4-hydroxyphenoxy]-5-methylanilino]-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 10165018 |
| Molecular Formula | C24H21ClFNO7S |
| Molecular Weight | 521.95 g/mol |
| Exact Mass | 521.07 |
| IUPAC Name | 3-[3-chloro-4-[3-[(4-fluorophenyl)methylsulfonyl]-4-hydroxyphenoxy]-5-methylanilino]-2-methyl-3-oxopropanoic acid |
| SMILES | Cc1cc(NC(=O)C(C)C(=O)O)cc(Cl)c1Oc1ccc(O)c(S(=O)(=O)Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C24H21ClFNO7S/c1-13-9-17(27-23(29)14(2)24(30)31)10-19(25)22(13)34-18-7-8-20(28)21(11-18)35(32,33)12-15-3-5-16(26)6-4-15/h3-11,14,28H,12H2,1-2H3,(H,27,29)(H,30,31) |
| InChIKey | BXPHNRHQMYFFFG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.95 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|