C16H14FNO4 — CID 18614062
2-[4-(4-fluorophenoxy)-3,5-dimethylanilino]-2-oxoacetic acid (PubChem CID 18614062) has the molecular formula C16H14FNO4 and a molecular weight of 303.29 g/mol. Its IUPAC name is 2-[4-(4-fluorophenoxy)-3,5-dimethylanilino]-2-oxoacetic acid.
| Compound Name | 2-[4-(4-fluorophenoxy)-3,5-dimethylanilino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 18614062 |
| Molecular Formula | C16H14FNO4 |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-[4-(4-fluorophenoxy)-3,5-dimethylanilino]-2-oxoacetic acid |
| SMILES | Cc1cc(NC(=O)C(=O)O)cc(C)c1Oc1ccc(F)cc1 |
| InChI | InChI=1S/C16H14FNO4/c1-9-7-12(18-15(19)16(20)21)8-10(2)14(9)22-13-5-3-11(17)4-6-13/h3-8H,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | NMPFRBSCTNYGPO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|