C20H24N2O7S — CID 10274703
2-[4-[3-(tert-butylsulfonylamino)-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetic acid (PubChem CID 10274703) has the molecular formula C20H24N2O7S and a molecular weight of 436.49 g/mol. Its IUPAC name is 2-[4-[3-(tert-butylsulfonylamino)-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetic acid.
| Compound Name | 2-[4-[3-(tert-butylsulfonylamino)-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 10274703 |
| Molecular Formula | C20H24N2O7S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 2-[4-[3-(tert-butylsulfonylamino)-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetic acid |
| SMILES | Cc1cc(NC(=O)C(=O)O)cc(C)c1Oc1ccc(O)c(NS(=O)(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C20H24N2O7S/c1-11-8-13(21-18(24)19(25)26)9-12(2)17(11)29-14-6-7-16(23)15(10-14)22-30(27,28)20(3,4)5/h6-10,22-23H,1-5H3,(H,21,24)(H,25,26) |
| InChIKey | JXRCGFMIYQYHGG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|