C30H30N2O4S — CID 59041827
N-[4-[3-[(4-tert-butylbenzoyl)amino]-4-hydroxyphenoxy]-3,5-dimethylphenyl]thiophene-2-carboxamide (PubChem CID 59041827) has the molecular formula C30H30N2O4S and a molecular weight of 514.65 g/mol. Its IUPAC name is N-[4-[3-[(4-tert-butylbenzoyl)amino]-4-hydroxyphenoxy]-3,5-dimethylphenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[3-[(4-tert-butylbenzoyl)amino]-4-hydroxyphenoxy]-3,5-dimethylphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 59041827 |
| Molecular Formula | C30H30N2O4S |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | N-[4-[3-[(4-tert-butylbenzoyl)amino]-4-hydroxyphenoxy]-3,5-dimethylphenyl]thiophene-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cccs2)cc(C)c1Oc1ccc(O)c(NC(=O)c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C30H30N2O4S/c1-18-15-22(31-29(35)26-7-6-14-37-26)16-19(2)27(18)36-23-12-13-25(33)24(17-23)32-28(34)20-8-10-21(11-9-20)30(3,4)5/h6-17,33H,1-5H3,(H,31,35)(H,32,34) |
| InChIKey | BEODCYHYDUQZJS-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|