C21H24N2O7S — CID 10275556
ethyl 2-[4-[3-(cyclopropylsulfonylamino)-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetate (PubChem CID 10275556) has the molecular formula C21H24N2O7S and a molecular weight of 448.50 g/mol. Its IUPAC name is ethyl 2-[4-[3-(cyclopropylsulfonylamino)-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetate.
| Compound Name | ethyl 2-[4-[3-(cyclopropylsulfonylamino)-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetate |
|---|---|
| PubChem CID | 10275556 |
| Molecular Formula | C21H24N2O7S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | ethyl 2-[4-[3-(cyclopropylsulfonylamino)-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1cc(C)c(Oc2ccc(O)c(NS(=O)(=O)C3CC3)c2)c(C)c1 |
| InChI | InChI=1S/C21H24N2O7S/c1-4-29-21(26)20(25)22-14-9-12(2)19(13(3)10-14)30-15-5-8-18(24)17(11-15)23-31(27,28)16-6-7-16/h5,8-11,16,23-24H,4,6-7H2,1-3H3,(H,22,25) |
| InChIKey | CPKMAEOHSHVQRP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|