C24H30N2O7S — CID 54037129
ethyl 2-[4-[3-(cyclohexylsulfamoyl)-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetate (PubChem CID 54037129) has the molecular formula C24H30N2O7S and a molecular weight of 490.58 g/mol. Its IUPAC name is ethyl 2-[4-[3-(cyclohexylsulfamoyl)-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetate.
| Compound Name | ethyl 2-[4-[3-(cyclohexylsulfamoyl)-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetate |
|---|---|
| PubChem CID | 54037129 |
| Molecular Formula | C24H30N2O7S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | ethyl 2-[4-[3-(cyclohexylsulfamoyl)-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1cc(C)c(Oc2ccc(O)c(S(=O)(=O)NC3CCCCC3)c2)c(C)c1 |
| InChI | InChI=1S/C24H30N2O7S/c1-4-32-24(29)23(28)25-18-12-15(2)22(16(3)13-18)33-19-10-11-20(27)21(14-19)34(30,31)26-17-8-6-5-7-9-17/h10-14,17,26-27H,4-9H2,1-3H3,(H,25,28) |
| InChIKey | LJTHQEXLEZKXIE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|