C21H22Cl2N2O7S — CID 22344955
3-[3,5-dichloro-4-[3-(cyclohexylsulfamoyl)-4-hydroxyphenoxy]anilino]-3-oxopropanoic acid (PubChem CID 22344955) has the molecular formula C21H22Cl2N2O7S and a molecular weight of 517.39 g/mol. Its IUPAC name is 3-[3,5-dichloro-4-[3-(cyclohexylsulfamoyl)-4-hydroxyphenoxy]anilino]-3-oxopropanoic acid.
| Compound Name | 3-[3,5-dichloro-4-[3-(cyclohexylsulfamoyl)-4-hydroxyphenoxy]anilino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 22344955 |
| Molecular Formula | C21H22Cl2N2O7S |
| Molecular Weight | 517.39 g/mol |
| Exact Mass | 516.05 |
| IUPAC Name | 3-[3,5-dichloro-4-[3-(cyclohexylsulfamoyl)-4-hydroxyphenoxy]anilino]-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)Nc1cc(Cl)c(Oc2ccc(O)c(S(=O)(=O)NC3CCCCC3)c2)c(Cl)c1 |
| InChI | InChI=1S/C21H22Cl2N2O7S/c22-15-8-13(24-19(27)11-20(28)29)9-16(23)21(15)32-14-6-7-17(26)18(10-14)33(30,31)25-12-4-2-1-3-5-12/h6-10,12,25-26H,1-5,11H2,(H,24,27)(H,28,29) |
| InChIKey | AABPJKWIABPCRF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|