C21H23NO7S — CID 69259534
3-[4-[3-(cyclobutylmethylsulfonyl)-4-hydroxyphenoxy]-3-methylanilino]-3-oxopropanoic acid (PubChem CID 69259534) has the molecular formula C21H23NO7S and a molecular weight of 433.48 g/mol. Its IUPAC name is 3-[4-[3-(cyclobutylmethylsulfonyl)-4-hydroxyphenoxy]-3-methylanilino]-3-oxopropanoic acid.
| Compound Name | 3-[4-[3-(cyclobutylmethylsulfonyl)-4-hydroxyphenoxy]-3-methylanilino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 69259534 |
| Molecular Formula | C21H23NO7S |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 3-[4-[3-(cyclobutylmethylsulfonyl)-4-hydroxyphenoxy]-3-methylanilino]-3-oxopropanoic acid |
| SMILES | Cc1cc(NC(=O)CC(=O)O)ccc1Oc1ccc(O)c(S(=O)(=O)CC2CCC2)c1 |
| InChI | InChI=1S/C21H23NO7S/c1-13-9-15(22-20(24)11-21(25)26)5-8-18(13)29-16-6-7-17(23)19(10-16)30(27,28)12-14-3-2-4-14/h5-10,14,23H,2-4,11-12H2,1H3,(H,22,24)(H,25,26) |
| InChIKey | PIXLUGIBCCGXBX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|