C25H31NO5 — CID 69258335
methyl 3-[4-[3-(2-cyclopentylethyl)-4-hydroxyphenoxy]-3,5-dimethylanilino]-3-oxopropanoate (PubChem CID 69258335) has the molecular formula C25H31NO5 and a molecular weight of 425.53 g/mol. Its IUPAC name is methyl 3-[4-[3-(2-cyclopentylethyl)-4-hydroxyphenoxy]-3,5-dimethylanilino]-3-oxopropanoate.
| Compound Name | methyl 3-[4-[3-(2-cyclopentylethyl)-4-hydroxyphenoxy]-3,5-dimethylanilino]-3-oxopropanoate |
|---|---|
| PubChem CID | 69258335 |
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | methyl 3-[4-[3-(2-cyclopentylethyl)-4-hydroxyphenoxy]-3,5-dimethylanilino]-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)Nc1cc(C)c(Oc2ccc(O)c(CCC3CCCC3)c2)c(C)c1 |
| InChI | InChI=1S/C25H31NO5/c1-16-12-20(26-23(28)15-24(29)30-3)13-17(2)25(16)31-21-10-11-22(27)19(14-21)9-8-18-6-4-5-7-18/h10-14,18,27H,4-9,15H2,1-3H3,(H,26,28) |
| InChIKey | ZXZUXPNJOLXZDE-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|