C20H25NO3 — CID 139998747
4-(4-amino-2,6-dimethylphenoxy)-2-[2-(oxolan-3-yl)ethyl]phenol (PubChem CID 139998747) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is 4-(4-amino-2,6-dimethylphenoxy)-2-[2-(oxolan-3-yl)ethyl]phenol.
| Compound Name | 4-(4-amino-2,6-dimethylphenoxy)-2-[2-(oxolan-3-yl)ethyl]phenol |
|---|---|
| PubChem CID | 139998747 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 4-(4-amino-2,6-dimethylphenoxy)-2-[2-(oxolan-3-yl)ethyl]phenol |
| SMILES | Cc1cc(N)cc(C)c1Oc1ccc(O)c(CCC2CCOC2)c1 |
| InChI | InChI=1S/C20H25NO3/c1-13-9-17(21)10-14(2)20(13)24-18-5-6-19(22)16(11-18)4-3-15-7-8-23-12-15/h5-6,9-11,15,22H,3-4,7-8,12,21H2,1-2H3 |
| InChIKey | GTWAOOQMGCWIEY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|