C42H52N2O4 — CID 70023317
4-(4-amino-2,6-dimethylphenoxy)-2-[3-[5-(4-amino-2,6-dimethylphenoxy)-2-hydroxyphenyl]-2,4-dicyclopentylbutyl]phenol (PubChem CID 70023317) has the molecular formula C42H52N2O4 and a molecular weight of 648.89 g/mol. Its IUPAC name is 4-(4-amino-2,6-dimethylphenoxy)-2-[3-[5-(4-amino-2,6-dimethylphenoxy)-2-hydroxyphenyl]-2,4-dicyclopentylbutyl]phenol.
| Compound Name | 4-(4-amino-2,6-dimethylphenoxy)-2-[3-[5-(4-amino-2,6-dimethylphenoxy)-2-hydroxyphenyl]-2,4-dicyclopentylbutyl]phenol |
|---|---|
| PubChem CID | 70023317 |
| Molecular Formula | C42H52N2O4 |
| Molecular Weight | 648.89 g/mol |
| Exact Mass | 648.39 |
| IUPAC Name | 4-(4-amino-2,6-dimethylphenoxy)-2-[3-[5-(4-amino-2,6-dimethylphenoxy)-2-hydroxyphenyl]-2,4-dicyclopentylbutyl]phenol |
| SMILES | Cc1cc(N)cc(C)c1Oc1ccc(O)c(CC(C2CCCC2)C(CC2CCCC2)c2cc(Oc3c(C)cc(N)cc3C)ccc2O)c1 |
| InChI | InChI=1S/C42H52N2O4/c1-25-17-32(43)18-26(2)41(25)47-34-13-15-39(45)31(22-34)23-36(30-11-7-8-12-30)37(21-29-9-5-6-10-29)38-24-35(14-16-40(38)46)48-42-27(3)19-33(44)20-28(42)4/h13-20,22,24,29-30,36-37,45-46H,5-12,21,23,43-44H2,1-4H3 |
| InChIKey | OQPZNIPCRBEAHN-UHFFFAOYSA-N |
| XLogP | 10.79 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.89 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|