C12H16O3 — CID 44611839
4-[2-(oxolan-3-yl)ethyl]benzene-1,3-diol (PubChem CID 44611839) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 4-[2-(oxolan-3-yl)ethyl]benzene-1,3-diol.
| Compound Name | 4-[2-(oxolan-3-yl)ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 44611839 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 4-[2-(oxolan-3-yl)ethyl]benzene-1,3-diol |
| SMILES | Oc1ccc(CCC2CCOC2)c(O)c1 |
| InChI | InChI=1S/C12H16O3/c13-11-4-3-10(12(14)7-11)2-1-9-5-6-15-8-9/h3-4,7,9,13-14H,1-2,5-6,8H2 |
| InChIKey | IOVVVXZZORLLSW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |