C14H16N2O2 — CID 129410623
3-[[(3R)-oxolan-3-yl]methylamino]quinolin-6-ol (PubChem CID 129410623) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 3-[[(3R)-oxolan-3-yl]methylamino]quinolin-6-ol.
| Compound Name | 3-[[(3R)-oxolan-3-yl]methylamino]quinolin-6-ol |
|---|---|
| PubChem CID | 129410623 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 3-[[(3R)-oxolan-3-yl]methylamino]quinolin-6-ol |
| SMILES | Oc1ccc2ncc(NC[C@H]3CCOC3)cc2c1 |
| InChI | InChI=1S/C14H16N2O2/c17-13-1-2-14-11(6-13)5-12(8-16-14)15-7-10-3-4-18-9-10/h1-2,5-6,8,10,15,17H,3-4,7,9H2/t10-/m1/s1 |
| InChIKey | VFEJXKXPQJCPOM-SNVBAGLBSA-N |
| XLogP | 2.39 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |