C21H19FO2 — CID 141126761
4-(2,6-dimethylphenoxy)-2-[(4-fluorophenyl)methyl]phenol (PubChem CID 141126761) has the molecular formula C21H19FO2 and a molecular weight of 322.38 g/mol. Its IUPAC name is 4-(2,6-dimethylphenoxy)-2-[(4-fluorophenyl)methyl]phenol.
| Compound Name | 4-(2,6-dimethylphenoxy)-2-[(4-fluorophenyl)methyl]phenol |
|---|---|
| PubChem CID | 141126761 |
| Molecular Formula | C21H19FO2 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 4-(2,6-dimethylphenoxy)-2-[(4-fluorophenyl)methyl]phenol |
| SMILES | Cc1cccc(C)c1Oc1ccc(O)c(Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C21H19FO2/c1-14-4-3-5-15(2)21(14)24-19-10-11-20(23)17(13-19)12-16-6-8-18(22)9-7-16/h3-11,13,23H,12H2,1-2H3 |
| InChIKey | WVCFXBJJRUDBQH-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |