C24H21NO6 — CID 139998737
3-[3-[[5-(2,6-dimethyl-4-nitrophenoxy)-2-hydroxyphenyl]methyl]phenyl]prop-2-enoic acid (PubChem CID 139998737) has the molecular formula C24H21NO6 and a molecular weight of 419.43 g/mol. Its IUPAC name is 3-[3-[[5-(2,6-dimethyl-4-nitrophenoxy)-2-hydroxyphenyl]methyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[[5-(2,6-dimethyl-4-nitrophenoxy)-2-hydroxyphenyl]methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 139998737 |
| Molecular Formula | C24H21NO6 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 3-[3-[[5-(2,6-dimethyl-4-nitrophenoxy)-2-hydroxyphenyl]methyl]phenyl]prop-2-enoic acid |
| SMILES | Cc1cc([N+](=O)[O-])cc(C)c1Oc1ccc(O)c(Cc2cccc(C=CC(=O)O)c2)c1 |
| InChI | InChI=1S/C24H21NO6/c1-15-10-20(25(29)30)11-16(2)24(15)31-21-7-8-22(26)19(14-21)13-18-5-3-4-17(12-18)6-9-23(27)28/h3-12,14,26H,13H2,1-2H3,(H,27,28) |
| InChIKey | FKTVLXKSTLVOBY-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|