C21H19FO2S — CID 142018538
2-(4-fluorophenyl)sulfanyl-4-(2,4,6-trimethylphenoxy)phenol (PubChem CID 142018538) has the molecular formula C21H19FO2S and a molecular weight of 354.45 g/mol. Its IUPAC name is 2-(4-fluorophenyl)sulfanyl-4-(2,4,6-trimethylphenoxy)phenol.
| Compound Name | 2-(4-fluorophenyl)sulfanyl-4-(2,4,6-trimethylphenoxy)phenol |
|---|---|
| PubChem CID | 142018538 |
| Molecular Formula | C21H19FO2S |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 2-(4-fluorophenyl)sulfanyl-4-(2,4,6-trimethylphenoxy)phenol |
| SMILES | Cc1cc(C)c(Oc2ccc(O)c(Sc3ccc(F)cc3)c2)c(C)c1 |
| InChI | InChI=1S/C21H19FO2S/c1-13-10-14(2)21(15(3)11-13)24-17-6-9-19(23)20(12-17)25-18-7-4-16(22)5-8-18/h4-12,23H,1-3H3 |
| InChIKey | FUKYQZSPIDSFDT-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |