C48H44F2N2O12 — CID 70023305
3-[4-[3-[(4-fluorophenyl)-hydroxymethyl]-4-hydroxyphenoxy]-3,5-dimethylanilino]-3-oxopropanoic acid (PubChem CID 70023305) has the molecular formula C48H44F2N2O12 and a molecular weight of 878.88 g/mol. Its IUPAC name is 3-[4-[3-[(4-fluorophenyl)-hydroxymethyl]-4-hydroxyphenoxy]-3,5-dimethylanilino]-3-oxopropanoic acid.
| Compound Name | 3-[4-[3-[(4-fluorophenyl)-hydroxymethyl]-4-hydroxyphenoxy]-3,5-dimethylanilino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 70023305 |
| Molecular Formula | C48H44F2N2O12 |
| Molecular Weight | 878.88 g/mol |
| Exact Mass | 878.29 |
| IUPAC Name | 3-[4-[3-[(4-fluorophenyl)-hydroxymethyl]-4-hydroxyphenoxy]-3,5-dimethylanilino]-3-oxopropanoic acid |
| SMILES | Cc1cc(NC(=O)CC(=O)O)cc(C)c1Oc1ccc(O)c(C(O)c2ccc(F)cc2)c1.Cc1cc(NC(=O)CC(=O)O)cc(C)c1Oc1ccc(O)c(C(O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/2C24H22FNO6/c2*1-13-9-17(26-21(28)12-22(29)30)10-14(2)24(13)32-18-7-8-20(27)19(11-18)23(31)15-3-5-16(25)6-4-15/h2*3-11,23,27,31H,12H2,1-2H3,(H,26,28)(H,29,30) |
| InChIKey | VNJMPDYQNLLCCZ-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 232.18 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.88 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|