C30H30N2O3 — CID 142200728
3-[4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-dimethylphenyl]-1,1-diphenylurea (PubChem CID 142200728) has the molecular formula C30H30N2O3 and a molecular weight of 466.58 g/mol. Its IUPAC name is 3-[4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-dimethylphenyl]-1,1-diphenylurea.
| Compound Name | 3-[4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-dimethylphenyl]-1,1-diphenylurea |
|---|---|
| PubChem CID | 142200728 |
| Molecular Formula | C30H30N2O3 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | 3-[4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-dimethylphenyl]-1,1-diphenylurea |
| SMILES | Cc1cc(NC(=O)N(c2ccccc2)c2ccccc2)cc(C)c1Oc1ccc(O)c(C(C)C)c1 |
| InChI | InChI=1S/C30H30N2O3/c1-20(2)27-19-26(15-16-28(27)33)35-29-21(3)17-23(18-22(29)4)31-30(34)32(24-11-7-5-8-12-24)25-13-9-6-10-14-25/h5-20,33H,1-4H3,(H,31,34) |
| InChIKey | JTFZIYBYSLMORN-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |