C24H27NO2S — CID 142200793
4-[4-(benzylsulfanylamino)-2,6-dimethylphenoxy]-2-propan-2-ylphenol (PubChem CID 142200793) has the molecular formula C24H27NO2S and a molecular weight of 393.55 g/mol. Its IUPAC name is 4-[4-(benzylsulfanylamino)-2,6-dimethylphenoxy]-2-propan-2-ylphenol.
| Compound Name | 4-[4-(benzylsulfanylamino)-2,6-dimethylphenoxy]-2-propan-2-ylphenol |
|---|---|
| PubChem CID | 142200793 |
| Molecular Formula | C24H27NO2S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 4-[4-(benzylsulfanylamino)-2,6-dimethylphenoxy]-2-propan-2-ylphenol |
| SMILES | Cc1cc(NSCc2ccccc2)cc(C)c1Oc1ccc(O)c(C(C)C)c1 |
| InChI | InChI=1S/C24H27NO2S/c1-16(2)22-14-21(10-11-23(22)26)27-24-17(3)12-20(13-18(24)4)25-28-15-19-8-6-5-7-9-19/h5-14,16,25-26H,15H2,1-4H3 |
| InChIKey | NFHMNNCZPKPVSL-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|