C20H25NO3S — CID 142200717
N-[4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-dimethylphenyl]prop-2-ene-1-sulfinamide (PubChem CID 142200717) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is N-[4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-dimethylphenyl]prop-2-ene-1-sulfinamide.
| Compound Name | N-[4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-dimethylphenyl]prop-2-ene-1-sulfinamide |
|---|---|
| PubChem CID | 142200717 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | N-[4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-dimethylphenyl]prop-2-ene-1-sulfinamide |
| SMILES | C=CCS(=O)Nc1cc(C)c(Oc2ccc(O)c(C(C)C)c2)c(C)c1 |
| InChI | InChI=1S/C20H25NO3S/c1-6-9-25(23)21-16-10-14(4)20(15(5)11-16)24-17-7-8-19(22)18(12-17)13(2)3/h6-8,10-13,21-22H,1,9H2,2-5H3 |
| InChIKey | WIJAHQZRDOHQOR-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|