C20H29O5P — CID 143340233
ethane;[4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-dimethylphenyl]methylphosphonic acid (PubChem CID 143340233) has the molecular formula C20H29O5P and a molecular weight of 380.42 g/mol. Its IUPAC name is ethane;[4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-dimethylphenyl]methylphosphonic acid.
| Compound Name | ethane;[4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-dimethylphenyl]methylphosphonic acid |
|---|---|
| PubChem CID | 143340233 |
| Molecular Formula | C20H29O5P |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | ethane;[4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-dimethylphenyl]methylphosphonic acid |
| SMILES | CC.Cc1cc(CP(=O)(O)O)cc(C)c1Oc1ccc(O)c(C(C)C)c1 |
| InChI | InChI=1S/C18H23O5P.C2H6/c1-11(2)16-9-15(5-6-17(16)19)23-18-12(3)7-14(8-13(18)4)10-24(20,21)22;1-2/h5-9,11,19H,10H2,1-4H3,(H2,20,21,22);1-2H3 |
| InChIKey | VDTHBNWZRIAAIO-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|