C22H28N2O4 — CID 90938223
ethyl 2-[[4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-dimethylphenyl]diazenyl]propanoate (PubChem CID 90938223) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is ethyl 2-[[4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-dimethylphenyl]diazenyl]propanoate.
| Compound Name | ethyl 2-[[4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-dimethylphenyl]diazenyl]propanoate |
|---|---|
| PubChem CID | 90938223 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | ethyl 2-[[4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-dimethylphenyl]diazenyl]propanoate |
| SMILES | CCOC(=O)C(C)/N=N/c1cc(C)c(Oc2ccc(O)c(C(C)C)c2)c(C)c1 |
| InChI | InChI=1S/C22H28N2O4/c1-7-27-22(26)16(6)23-24-17-10-14(4)21(15(5)11-17)28-18-8-9-20(25)19(12-18)13(2)3/h8-13,16,25H,7H2,1-6H3/b24-23+ |
| InChIKey | VTVQPVSRCIRJNL-WCWDXBQESA-N |
| XLogP | 5.96 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|