C18H19BrO4 — CID 18415138
2-[3-bromo-4-(4-hydroxy-3-propan-2-ylphenoxy)-5-methylphenyl]acetic acid (PubChem CID 18415138) has the molecular formula C18H19BrO4 and a molecular weight of 379.25 g/mol. Its IUPAC name is 2-[3-bromo-4-(4-hydroxy-3-propan-2-ylphenoxy)-5-methylphenyl]acetic acid.
| Compound Name | 2-[3-bromo-4-(4-hydroxy-3-propan-2-ylphenoxy)-5-methylphenyl]acetic acid |
|---|---|
| PubChem CID | 18415138 |
| Molecular Formula | C18H19BrO4 |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 2-[3-bromo-4-(4-hydroxy-3-propan-2-ylphenoxy)-5-methylphenyl]acetic acid |
| SMILES | Cc1cc(CC(=O)O)cc(Br)c1Oc1ccc(O)c(C(C)C)c1 |
| InChI | InChI=1S/C18H19BrO4/c1-10(2)14-9-13(4-5-16(14)20)23-18-11(3)6-12(7-15(18)19)8-17(21)22/h4-7,9-10,20H,8H2,1-3H3,(H,21,22) |
| InChIKey | DQLDGNUFEBSACT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |