C21H22Br2INO6 — CID 87656600
2-[[2-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)phenyl]acetyl]-iodoamino]-4-hydroxybutanoic acid (PubChem CID 87656600) has the molecular formula C21H22Br2INO6 and a molecular weight of 671.12 g/mol. Its IUPAC name is 2-[[2-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)phenyl]acetyl]-iodoamino]-4-hydroxybutanoic acid.
| Compound Name | 2-[[2-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)phenyl]acetyl]-iodoamino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 87656600 |
| Molecular Formula | C21H22Br2INO6 |
| Molecular Weight | 671.12 g/mol |
| Exact Mass | 668.89 |
| IUPAC Name | 2-[[2-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)phenyl]acetyl]-iodoamino]-4-hydroxybutanoic acid |
| SMILES | CC(C)c1cc(Oc2c(Br)cc(CC(=O)N(I)C(CCO)C(=O)O)cc2Br)ccc1O |
| InChI | InChI=1S/C21H22Br2INO6/c1-11(2)14-10-13(3-4-18(14)27)31-20-15(22)7-12(8-16(20)23)9-19(28)25(24)17(5-6-26)21(29)30/h3-4,7-8,10-11,17,26-27H,5-6,9H2,1-2H3,(H,29,30) |
| InChIKey | QIHAUBSWLACGSG-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.12 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|