C17H19Br2O4P — CID 68534585
2-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)phenyl]ethylphosphonous acid (PubChem CID 68534585) has the molecular formula C17H19Br2O4P and a molecular weight of 478.12 g/mol. Its IUPAC name is 2-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)phenyl]ethylphosphonous acid.
| Compound Name | 2-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)phenyl]ethylphosphonous acid |
|---|---|
| PubChem CID | 68534585 |
| Molecular Formula | C17H19Br2O4P |
| Molecular Weight | 478.12 g/mol |
| Exact Mass | 475.94 |
| IUPAC Name | 2-[3,5-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)phenyl]ethylphosphonous acid |
| SMILES | CC(C)c1cc(Oc2c(Br)cc(CCP(O)O)cc2Br)ccc1O |
| InChI | InChI=1S/C17H19Br2O4P/c1-10(2)13-9-12(3-4-16(13)20)23-17-14(18)7-11(8-15(17)19)5-6-24(21)22/h3-4,7-10,20-22H,5-6H2,1-2H3 |
| InChIKey | AIDPSPPMVCUYHV-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.12 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|