C18H21Br2O6P — CID 129066882
[2,6-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-dimethylphenoxy]methylphosphonic acid (PubChem CID 129066882) has the molecular formula C18H21Br2O6P and a molecular weight of 524.14 g/mol. Its IUPAC name is [2,6-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-dimethylphenoxy]methylphosphonic acid.
| Compound Name | [2,6-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-dimethylphenoxy]methylphosphonic acid |
|---|---|
| PubChem CID | 129066882 |
| Molecular Formula | C18H21Br2O6P |
| Molecular Weight | 524.14 g/mol |
| Exact Mass | 521.94 |
| IUPAC Name | [2,6-dibromo-4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-dimethylphenoxy]methylphosphonic acid |
| SMILES | Cc1c(Br)c(OCP(=O)(O)O)c(Br)c(C)c1Oc1ccc(O)c(C(C)C)c1 |
| InChI | InChI=1S/C18H21Br2O6P/c1-9(2)13-7-12(5-6-14(13)21)26-17-10(3)15(19)18(16(20)11(17)4)25-8-27(22,23)24/h5-7,9,21H,8H2,1-4H3,(H2,22,23,24) |
| InChIKey | UTBIBANFAWISLV-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.14 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|