C17H19Cl2O6P — CID 143340199
[3,5-dichloro-4-(4-hydroxy-3-propan-2-ylphenoxy)phenoxy]methyl-methoxyphosphinic acid (PubChem CID 143340199) has the molecular formula C17H19Cl2O6P and a molecular weight of 421.21 g/mol. Its IUPAC name is [3,5-dichloro-4-(4-hydroxy-3-propan-2-ylphenoxy)phenoxy]methyl-methoxyphosphinic acid.
| Compound Name | [3,5-dichloro-4-(4-hydroxy-3-propan-2-ylphenoxy)phenoxy]methyl-methoxyphosphinic acid |
|---|---|
| PubChem CID | 143340199 |
| Molecular Formula | C17H19Cl2O6P |
| Molecular Weight | 421.21 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | [3,5-dichloro-4-(4-hydroxy-3-propan-2-ylphenoxy)phenoxy]methyl-methoxyphosphinic acid |
| SMILES | COP(=O)(O)COc1cc(Cl)c(Oc2ccc(O)c(C(C)C)c2)c(Cl)c1 |
| InChI | InChI=1S/C17H19Cl2O6P/c1-10(2)13-6-11(4-5-16(13)20)25-17-14(18)7-12(8-15(17)19)24-9-26(21,22)23-3/h4-8,10,20H,9H2,1-3H3,(H,21,22) |
| InChIKey | QKMUDLGJWNDHBV-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.21 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|