C24H24Cl2FO5P — CID 86603456
4-[2,6-dichloro-4-(diethoxyphosphorylmethyl)phenoxy]-2-[(4-fluorophenyl)methyl]phenol (PubChem CID 86603456) has the molecular formula C24H24Cl2FO5P and a molecular weight of 513.33 g/mol. Its IUPAC name is 4-[2,6-dichloro-4-(diethoxyphosphorylmethyl)phenoxy]-2-[(4-fluorophenyl)methyl]phenol.
| Compound Name | 4-[2,6-dichloro-4-(diethoxyphosphorylmethyl)phenoxy]-2-[(4-fluorophenyl)methyl]phenol |
|---|---|
| PubChem CID | 86603456 |
| Molecular Formula | C24H24Cl2FO5P |
| Molecular Weight | 513.33 g/mol |
| Exact Mass | 512.07 |
| IUPAC Name | 4-[2,6-dichloro-4-(diethoxyphosphorylmethyl)phenoxy]-2-[(4-fluorophenyl)methyl]phenol |
| SMILES | CCOP(=O)(Cc1cc(Cl)c(Oc2ccc(O)c(Cc3ccc(F)cc3)c2)c(Cl)c1)OCC |
| InChI | InChI=1S/C24H24Cl2FO5P/c1-3-30-33(29,31-4-2)15-17-12-21(25)24(22(26)13-17)32-20-9-10-23(28)18(14-20)11-16-5-7-19(27)8-6-16/h5-10,12-14,28H,3-4,11,15H2,1-2H3 |
| InChIKey | OZXRACBWBCPONI-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.33 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|