C19H23F2O5P — CID 129060864
[difluoro-[4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-dimethylphenoxy]methyl]-methylphosphinic acid (PubChem CID 129060864) has the molecular formula C19H23F2O5P and a molecular weight of 400.36 g/mol. Its IUPAC name is [difluoro-[4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-dimethylphenoxy]methyl]-methylphosphinic acid.
| Compound Name | [difluoro-[4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-dimethylphenoxy]methyl]-methylphosphinic acid |
|---|---|
| PubChem CID | 129060864 |
| Molecular Formula | C19H23F2O5P |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | [difluoro-[4-(4-hydroxy-3-propan-2-ylphenoxy)-3,5-dimethylphenoxy]methyl]-methylphosphinic acid |
| SMILES | Cc1cc(OC(F)(F)P(C)(=O)O)cc(C)c1Oc1ccc(O)c(C(C)C)c1 |
| InChI | InChI=1S/C19H23F2O5P/c1-11(2)16-10-14(6-7-17(16)22)25-18-12(3)8-15(9-13(18)4)26-19(20,21)27(5,23)24/h6-11,22H,1-5H3,(H,23,24) |
| InChIKey | SGIULROVWJXYMK-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|