C20H23O5P — CID 129060865
[5-(4-hydroxy-3-propan-2-ylphenoxy)-4,6-dimethyl-1-benzofuran-2-yl]-methylphosphinic acid (PubChem CID 129060865) has the molecular formula C20H23O5P and a molecular weight of 374.37 g/mol. Its IUPAC name is [5-(4-hydroxy-3-propan-2-ylphenoxy)-4,6-dimethyl-1-benzofuran-2-yl]-methylphosphinic acid.
| Compound Name | [5-(4-hydroxy-3-propan-2-ylphenoxy)-4,6-dimethyl-1-benzofuran-2-yl]-methylphosphinic acid |
|---|---|
| PubChem CID | 129060865 |
| Molecular Formula | C20H23O5P |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | [5-(4-hydroxy-3-propan-2-ylphenoxy)-4,6-dimethyl-1-benzofuran-2-yl]-methylphosphinic acid |
| SMILES | Cc1cc2oc(P(C)(=O)O)cc2c(C)c1Oc1ccc(O)c(C(C)C)c1 |
| InChI | InChI=1S/C20H23O5P/c1-11(2)15-9-14(6-7-17(15)21)24-20-12(3)8-18-16(13(20)4)10-19(25-18)26(5,22)23/h6-11,21H,1-5H3,(H,22,23) |
| InChIKey | QTROGPBSTIWFAK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|