C24H26ClI2NO2 — CID 44537330
4-[4-[2-(benzylamino)ethyl]-2,6-diiodophenoxy]-2-propan-2-ylphenol;hydrochloride (PubChem CID 44537330) has the molecular formula C24H26ClI2NO2 and a molecular weight of 649.74 g/mol. Its IUPAC name is 4-[4-[2-(benzylamino)ethyl]-2,6-diiodophenoxy]-2-propan-2-ylphenol;hydrochloride.
| Compound Name | 4-[4-[2-(benzylamino)ethyl]-2,6-diiodophenoxy]-2-propan-2-ylphenol;hydrochloride |
|---|---|
| PubChem CID | 44537330 |
| Molecular Formula | C24H26ClI2NO2 |
| Molecular Weight | 649.74 g/mol |
| Exact Mass | 648.97 |
| IUPAC Name | 4-[4-[2-(benzylamino)ethyl]-2,6-diiodophenoxy]-2-propan-2-ylphenol;hydrochloride |
| SMILES | CC(C)c1cc(Oc2c(I)cc(CCNCc3ccccc3)cc2I)ccc1O.Cl |
| InChI | InChI=1S/C24H25I2NO2.ClH/c1-16(2)20-14-19(8-9-23(20)28)29-24-21(25)12-18(13-22(24)26)10-11-27-15-17-6-4-3-5-7-17;/h3-9,12-14,16,27-28H,10-11,15H2,1-2H3;1H |
| InChIKey | GKAFLWLDLIMRQK-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.74 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|