C19H25ClINO2 — CID 2982533
N-[(3,4-diethoxy-5-iodophenyl)methyl]-2-phenylethanamine;hydrochloride (PubChem CID 2982533) has the molecular formula C19H25ClINO2 and a molecular weight of 461.77 g/mol. Its IUPAC name is N-[(3,4-diethoxy-5-iodophenyl)methyl]-2-phenylethanamine;hydrochloride.
| Compound Name | N-[(3,4-diethoxy-5-iodophenyl)methyl]-2-phenylethanamine;hydrochloride |
|---|---|
| PubChem CID | 2982533 |
| Molecular Formula | C19H25ClINO2 |
| Molecular Weight | 461.77 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | N-[(3,4-diethoxy-5-iodophenyl)methyl]-2-phenylethanamine;hydrochloride |
| SMILES | CCOc1cc(CNCCc2ccccc2)cc(I)c1OCC.Cl |
| InChI | InChI=1S/C19H24INO2.ClH/c1-3-22-18-13-16(12-17(20)19(18)23-4-2)14-21-11-10-15-8-6-5-7-9-15;/h5-9,12-13,21H,3-4,10-11,14H2,1-2H3;1H |
| InChIKey | CCMSDAVLQSJMQL-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.77 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|