C13H20INO2 — CID 2213024
N-[(3,4-diethoxy-5-iodophenyl)methyl]ethanamine (PubChem CID 2213024) has the molecular formula C13H20INO2 and a molecular weight of 349.21 g/mol. Its IUPAC name is N-[(3,4-diethoxy-5-iodophenyl)methyl]ethanamine.
| Compound Name | N-[(3,4-diethoxy-5-iodophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 2213024 |
| Molecular Formula | C13H20INO2 |
| Molecular Weight | 349.21 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | N-[(3,4-diethoxy-5-iodophenyl)methyl]ethanamine |
| SMILES | CCNCc1cc(I)c(OCC)c(OCC)c1 |
| InChI | InChI=1S/C13H20INO2/c1-4-15-9-10-7-11(14)13(17-6-3)12(8-10)16-5-2/h7-8,15H,4-6,9H2,1-3H3 |
| InChIKey | YLWPVGOBUASGBL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.21 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|