C13H17BrN2O2 — CID 60889105
2-[2-bromo-6-ethoxy-4-(ethylaminomethyl)phenoxy]acetonitrile (PubChem CID 60889105) has the molecular formula C13H17BrN2O2 and a molecular weight of 313.20 g/mol. Its IUPAC name is 2-[2-bromo-6-ethoxy-4-(ethylaminomethyl)phenoxy]acetonitrile.
| Compound Name | 2-[2-bromo-6-ethoxy-4-(ethylaminomethyl)phenoxy]acetonitrile |
|---|---|
| PubChem CID | 60889105 |
| Molecular Formula | C13H17BrN2O2 |
| Molecular Weight | 313.20 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 2-[2-bromo-6-ethoxy-4-(ethylaminomethyl)phenoxy]acetonitrile |
| SMILES | CCNCc1cc(Br)c(OCC#N)c(OCC)c1 |
| InChI | InChI=1S/C13H17BrN2O2/c1-3-16-9-10-7-11(14)13(18-6-5-15)12(8-10)17-4-2/h7-8,16H,3-4,6,9H2,1-2H3 |
| InChIKey | HOUYQALNPIBVEU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.20 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |