C12H14Br2N2O2 — CID 107744697
2-[2,6-dibromo-4-[(2-methoxyethylamino)methyl]phenoxy]acetonitrile (PubChem CID 107744697) has the molecular formula C12H14Br2N2O2 and a molecular weight of 378.06 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-[(2-methoxyethylamino)methyl]phenoxy]acetonitrile.
| Compound Name | 2-[2,6-dibromo-4-[(2-methoxyethylamino)methyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 107744697 |
| Molecular Formula | C12H14Br2N2O2 |
| Molecular Weight | 378.06 g/mol |
| Exact Mass | 375.94 |
| IUPAC Name | 2-[2,6-dibromo-4-[(2-methoxyethylamino)methyl]phenoxy]acetonitrile |
| SMILES | COCCNCc1cc(Br)c(OCC#N)c(Br)c1 |
| InChI | InChI=1S/C12H14Br2N2O2/c1-17-5-3-16-8-9-6-10(13)12(11(14)7-9)18-4-2-15/h6-7,16H,3-5,8H2,1H3 |
| InChIKey | VNXHUEAUURIKEE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.06 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|