C13H18Br2N2O3 — CID 107744887
2-[2,6-dibromo-4-[(2-methoxyethylamino)methyl]phenoxy]-N-methylacetamide (PubChem CID 107744887) has the molecular formula C13H18Br2N2O3 and a molecular weight of 410.11 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-[(2-methoxyethylamino)methyl]phenoxy]-N-methylacetamide.
| Compound Name | 2-[2,6-dibromo-4-[(2-methoxyethylamino)methyl]phenoxy]-N-methylacetamide |
|---|---|
| PubChem CID | 107744887 |
| Molecular Formula | C13H18Br2N2O3 |
| Molecular Weight | 410.11 g/mol |
| Exact Mass | 407.97 |
| IUPAC Name | 2-[2,6-dibromo-4-[(2-methoxyethylamino)methyl]phenoxy]-N-methylacetamide |
| SMILES | CNC(=O)COc1c(Br)cc(CNCCOC)cc1Br |
| InChI | InChI=1S/C13H18Br2N2O3/c1-16-12(18)8-20-13-10(14)5-9(6-11(13)15)7-17-3-4-19-2/h5-6,17H,3-4,7-8H2,1-2H3,(H,16,18) |
| InChIKey | YSGLHSBERQBLBJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.11 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|