C14H21Br2NO2 — CID 107742112
N-[[3,5-dibromo-4-(4-methoxybutoxy)phenyl]methyl]ethanamine (PubChem CID 107742112) has the molecular formula C14H21Br2NO2 and a molecular weight of 395.14 g/mol. Its IUPAC name is N-[[3,5-dibromo-4-(4-methoxybutoxy)phenyl]methyl]ethanamine.
| Compound Name | N-[[3,5-dibromo-4-(4-methoxybutoxy)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 107742112 |
| Molecular Formula | C14H21Br2NO2 |
| Molecular Weight | 395.14 g/mol |
| Exact Mass | 392.99 |
| IUPAC Name | N-[[3,5-dibromo-4-(4-methoxybutoxy)phenyl]methyl]ethanamine |
| SMILES | CCNCc1cc(Br)c(OCCCCOC)c(Br)c1 |
| InChI | InChI=1S/C14H21Br2NO2/c1-3-17-10-11-8-12(15)14(13(16)9-11)19-7-5-4-6-18-2/h8-9,17H,3-7,10H2,1-2H3 |
| InChIKey | ONNGTWQXASBUDS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.14 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|