C12H14BrN5O2 — CID 168592088
2-[[3-bromo-4-(cyanomethoxy)-5-ethoxyphenyl]methylideneamino]guanidine (PubChem CID 168592088) has the molecular formula C12H14BrN5O2 and a molecular weight of 340.18 g/mol. Its IUPAC name is 2-[[3-bromo-4-(cyanomethoxy)-5-ethoxyphenyl]methylideneamino]guanidine.
| Compound Name | 2-[[3-bromo-4-(cyanomethoxy)-5-ethoxyphenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 168592088 |
| Molecular Formula | C12H14BrN5O2 |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 2-[[3-bromo-4-(cyanomethoxy)-5-ethoxyphenyl]methylideneamino]guanidine |
| SMILES | CCOc1cc(C=NN=C(N)N)cc(Br)c1OCC#N |
| InChI | InChI=1S/C12H14BrN5O2/c1-2-19-10-6-8(7-17-18-12(15)16)5-9(13)11(10)20-4-3-14/h5-7H,2,4H2,1H3,(H4,15,16,18) |
| InChIKey | VBVGTGYPQBSHAE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 119.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|