C20H19BrN4O2 — CID 2716663
2-[[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]guanidine (PubChem CID 2716663) has the molecular formula C20H19BrN4O2 and a molecular weight of 427.30 g/mol. Its IUPAC name is 2-[[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]guanidine.
| Compound Name | 2-[[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 2716663 |
| Molecular Formula | C20H19BrN4O2 |
| Molecular Weight | 427.30 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | 2-[[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]guanidine |
| SMILES | COc1cc(C=NN=C(N)N)cc(Br)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C20H19BrN4O2/c1-26-18-10-13(11-24-25-20(22)23)9-17(21)19(18)27-12-15-7-4-6-14-5-2-3-8-16(14)15/h2-11H,12H2,1H3,(H4,22,23,25) |
| InChIKey | MZYDPINYIXUVKM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.30 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|