C37H27BrN2O4 — CID 124586936
(15R,19R)-17-[(Z)-[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 124586936) has the molecular formula C37H27BrN2O4 and a molecular weight of 643.54 g/mol. Its IUPAC name is (15R,19R)-17-[(Z)-[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15R,19R)-17-[(Z)-[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 124586936 |
| Molecular Formula | C37H27BrN2O4 |
| Molecular Weight | 643.54 g/mol |
| Exact Mass | 642.12 |
| IUPAC Name | (15R,19R)-17-[(Z)-[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | COc1cc(/C=N\N2C(=O)[C@@H]3C4c5ccccc5C(c5ccccc54)[C@H]3C2=O)cc(Br)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C37H27BrN2O4/c1-43-30-18-21(17-29(38)35(30)44-20-23-11-8-10-22-9-2-3-12-24(22)23)19-39-40-36(41)33-31-25-13-4-5-14-26(25)32(34(33)37(40)42)28-16-7-6-15-27(28)31/h2-19,31-34H,20H2,1H3/b39-19-/t31?,32?,33-,34-/m1/s1 |
| InChIKey | HNZDXAHBYNNTOZ-RZOPMIKZSA-N |
| XLogP | 7.42 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.54 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|