C36H24Br2N2O3 — CID 126154113
(15S,19R)-17-[(Z)-[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 126154113) has the molecular formula C36H24Br2N2O3 and a molecular weight of 692.41 g/mol. Its IUPAC name is (15S,19R)-17-[(Z)-[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15S,19R)-17-[(Z)-[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 126154113 |
| Molecular Formula | C36H24Br2N2O3 |
| Molecular Weight | 692.41 g/mol |
| Exact Mass | 690.02 |
| IUPAC Name | (15S,19R)-17-[(Z)-[3,5-dibromo-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | O=C1[C@@H]2C3c4ccccc4C(c4ccccc43)[C@@H]2C(=O)N1/N=C\c1cc(Br)c(OCc2cccc3ccccc23)c(Br)c1 |
| InChI | InChI=1S/C36H24Br2N2O3/c37-28-16-20(17-29(38)34(28)43-19-22-10-7-9-21-8-1-2-11-23(21)22)18-39-40-35(41)32-30-24-12-3-4-13-25(24)31(33(32)36(40)42)27-15-6-5-14-26(27)30/h1-18,30-33H,19H2/b39-18-/t30?,31?,32-,33+ |
| InChIKey | ZMHHKWREEVBFER-YCNOSXQHSA-N |
| XLogP | 8.17 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.41 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|