C33H24BrClN2O4 — CID 126086394
(15S,19S)-17-[(Z)-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 126086394) has the molecular formula C33H24BrClN2O4 and a molecular weight of 627.92 g/mol. Its IUPAC name is (15S,19S)-17-[(Z)-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15S,19S)-17-[(Z)-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 126086394 |
| Molecular Formula | C33H24BrClN2O4 |
| Molecular Weight | 627.92 g/mol |
| Exact Mass | 626.06 |
| IUPAC Name | (15S,19S)-17-[(Z)-[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | COc1cc(/C=N\N2C(=O)[C@H]3C4c5ccccc5C(c5ccccc54)[C@@H]3C2=O)cc(Br)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C33H24BrClN2O4/c1-40-26-15-19(14-25(34)31(26)41-17-18-10-12-20(35)13-11-18)16-36-37-32(38)29-27-21-6-2-3-7-22(21)28(30(29)33(37)39)24-9-5-4-8-23(24)27/h2-16,27-30H,17H2,1H3/b36-16-/t27?,28?,29-,30-/m0/s1 |
| InChIKey | CZIVVNYNHJPXSU-VBYXCVOGSA-N |
| XLogP | 6.92 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.92 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|