C25H23BrN2O4 — CID 100814793
(1S,2R,6R,7S)-4-[(Z)-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 100814793) has the molecular formula C25H23BrN2O4 and a molecular weight of 495.37 g/mol. Its IUPAC name is (1S,2R,6R,7S)-4-[(Z)-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | (1S,2R,6R,7S)-4-[(Z)-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 100814793 |
| Molecular Formula | C25H23BrN2O4 |
| Molecular Weight | 495.37 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | (1S,2R,6R,7S)-4-[(Z)-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | COc1cc(/C=N\N2C(=O)[C@H]3[C@H](C2=O)[C@@H]2C=C[C@@H]3CC2)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C25H23BrN2O4/c1-31-20-12-16(11-19(26)23(20)32-14-15-5-3-2-4-6-15)13-27-28-24(29)21-17-7-8-18(10-9-17)22(21)25(28)30/h2-8,11-13,17-18,21-22H,9-10,14H2,1H3/b27-13-/t17-,18-,21-,22-/m1/s1 |
| InChIKey | AFTJQLPUITVNHR-VMYKRZPZSA-N |
| XLogP | 4.57 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.37 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|