C26H24BrClN2O4 — CID 100814885
(1S,2S,6R,7S)-4-[(Z)-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 100814885) has the molecular formula C26H24BrClN2O4 and a molecular weight of 543.85 g/mol. Its IUPAC name is (1S,2S,6R,7S)-4-[(Z)-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | (1S,2S,6R,7S)-4-[(Z)-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 100814885 |
| Molecular Formula | C26H24BrClN2O4 |
| Molecular Weight | 543.85 g/mol |
| Exact Mass | 542.06 |
| IUPAC Name | (1S,2S,6R,7S)-4-[(Z)-[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | CCOc1cc(/C=N\N2C(=O)[C@@H]3[C@H](C2=O)[C@@H]2C=C[C@@H]3CC2)cc(Br)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C26H24BrClN2O4/c1-2-33-21-12-15(11-19(27)24(21)34-14-18-5-3-4-6-20(18)28)13-29-30-25(31)22-16-7-8-17(10-9-16)23(22)26(30)32/h3-8,11-13,16-17,22-23H,2,9-10,14H2,1H3/b29-13-/t16-,17-,22-,23+/m1/s1 |
| InChIKey | CAROEARBRMCBJF-RGVZPTKQSA-N |
| XLogP | 5.61 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.85 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|