C26H22BrN3O4 — CID 126413009
2-[[2-bromo-4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-ethoxyphenoxy]methyl]benzonitrile (PubChem CID 126413009) has the molecular formula C26H22BrN3O4 and a molecular weight of 520.38 g/mol. Its IUPAC name is 2-[[2-bromo-4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-ethoxyphenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2-bromo-4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-ethoxyphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126413009 |
| Molecular Formula | C26H22BrN3O4 |
| Molecular Weight | 520.38 g/mol |
| Exact Mass | 519.08 |
| IUPAC Name | 2-[[2-bromo-4-[[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]iminomethyl]-6-ethoxyphenoxy]methyl]benzonitrile |
| SMILES | CCOc1cc(C=NN2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)cc(Br)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C26H22BrN3O4/c1-2-33-21-10-15(9-20(27)24(21)34-14-19-6-4-3-5-18(19)12-28)13-29-30-25(31)22-16-7-8-17(11-16)23(22)26(30)32/h3-10,13,16-17,22-23H,2,11,14H2,1H3/t16-,17-,22-,23+/m0/s1 |
| InChIKey | YYRHQDNZJYJYMA-BSWISCRUSA-N |
| XLogP | 4.44 |
| TPSA | 91.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.38 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|