C24H18Br2Cl2N2O3 — CID 126148994
(1R,2R,6R,7R)-4-[(Z)-[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 126148994) has the molecular formula C24H18Br2Cl2N2O3 and a molecular weight of 613.13 g/mol. Its IUPAC name is (1R,2R,6R,7R)-4-[(Z)-[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6R,7R)-4-[(Z)-[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 126148994 |
| Molecular Formula | C24H18Br2Cl2N2O3 |
| Molecular Weight | 613.13 g/mol |
| Exact Mass | 609.91 |
| IUPAC Name | (1R,2R,6R,7R)-4-[(Z)-[3,5-dibromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | O=C1[C@H]2[C@H](C(=O)N1/N=C\c1cc(Br)c(OCc3ccc(Cl)cc3Cl)c(Br)c1)[C@H]1C=C[C@H]2CC1 |
| InChI | InChI=1S/C24H18Br2Cl2N2O3/c25-17-7-12(8-18(26)22(17)33-11-15-5-6-16(27)9-19(15)28)10-29-30-23(31)20-13-1-2-14(4-3-13)21(20)24(30)32/h1-2,5-10,13-14,20-21H,3-4,11H2/b29-10-/t13-,14-,20+,21+/m0/s1 |
| InChIKey | BLDFEVLHEXMFSA-QCFNJJAVSA-N |
| XLogP | 6.63 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.13 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|