C23H18Cl2N2O3 — CID 3298717
4-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 3298717) has the molecular formula C23H18Cl2N2O3 and a molecular weight of 441.31 g/mol. Its IUPAC name is 4-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 4-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 3298717 |
| Molecular Formula | C23H18Cl2N2O3 |
| Molecular Weight | 441.31 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 4-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1C2C3C=CC(C3)C2C(=O)N1N=Cc1ccc(OCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C23H18Cl2N2O3/c24-17-6-5-16(19(25)10-17)12-30-18-7-1-13(2-8-18)11-26-27-22(28)20-14-3-4-15(9-14)21(20)23(27)29/h1-8,10-11,14-15,20-21H,9,12H2 |
| InChIKey | HHYJFDVMDIHQTN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.31 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|