C24H19BrCl2N2O4 — CID 126413155
(1R,2R,6S,7R)-4-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 126413155) has the molecular formula C24H19BrCl2N2O4 and a molecular weight of 550.24 g/mol. Its IUPAC name is (1R,2R,6S,7R)-4-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6S,7R)-4-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 126413155 |
| Molecular Formula | C24H19BrCl2N2O4 |
| Molecular Weight | 550.24 g/mol |
| Exact Mass | 547.99 |
| IUPAC Name | (1R,2R,6S,7R)-4-[[2-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | COc1cc(C=NN2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)c(Br)cc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H19BrCl2N2O4/c1-32-19-7-15(17(25)9-20(19)33-11-14-4-5-16(26)8-18(14)27)10-28-29-23(30)21-12-2-3-13(6-12)22(21)24(29)31/h2-5,7-10,12-13,21-22H,6,11H2,1H3/t12-,13-,21-,22+/m0/s1 |
| InChIKey | ZKMOQJIWGSLAEX-TXMYPURDSA-N |
| XLogP | 5.48 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.24 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|