C24H18Br4N2O4 — CID 126411025
(1R,2R,6S,7R)-4-[[2,3-dibromo-4-[(2,4-dibromophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 126411025) has the molecular formula C24H18Br4N2O4 and a molecular weight of 718.03 g/mol. Its IUPAC name is (1R,2R,6S,7R)-4-[[2,3-dibromo-4-[(2,4-dibromophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6S,7R)-4-[[2,3-dibromo-4-[(2,4-dibromophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 126411025 |
| Molecular Formula | C24H18Br4N2O4 |
| Molecular Weight | 718.03 g/mol |
| Exact Mass | 713.80 |
| IUPAC Name | (1R,2R,6S,7R)-4-[[2,3-dibromo-4-[(2,4-dibromophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | COc1cc(C=NN2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)c(Br)c(Br)c1OCc1ccc(Br)cc1Br |
| InChI | InChI=1S/C24H18Br4N2O4/c1-33-17-7-14(9-29-30-23(31)18-11-2-3-12(6-11)19(18)24(30)32)20(27)21(28)22(17)34-10-13-4-5-15(25)8-16(13)26/h2-5,7-9,11-12,18-19H,6,10H2,1H3/t11-,12-,18-,19+/m0/s1 |
| InChIKey | KMZUTXLGFQPRKM-OGCKGYDTSA-N |
| XLogP | 6.47 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.03 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|