C21H22BrClN2O4 — CID 126408073
(1R,2R,6S,7R)-4-[[2-bromo-4-[(2S)-butan-2-yl]oxy-3-chloro-5-methoxyphenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 126408073) has the molecular formula C21H22BrClN2O4 and a molecular weight of 481.77 g/mol. Its IUPAC name is (1R,2R,6S,7R)-4-[[2-bromo-4-[(2S)-butan-2-yl]oxy-3-chloro-5-methoxyphenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6S,7R)-4-[[2-bromo-4-[(2S)-butan-2-yl]oxy-3-chloro-5-methoxyphenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 126408073 |
| Molecular Formula | C21H22BrClN2O4 |
| Molecular Weight | 481.77 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | (1R,2R,6S,7R)-4-[[2-bromo-4-[(2S)-butan-2-yl]oxy-3-chloro-5-methoxyphenyl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CC[C@H](C)Oc1c(OC)cc(C=NN2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)c(Br)c1Cl |
| InChI | InChI=1S/C21H22BrClN2O4/c1-4-10(2)29-19-14(28-3)8-13(17(22)18(19)23)9-24-25-20(26)15-11-5-6-12(7-11)16(15)21(25)27/h5-6,8-12,15-16H,4,7H2,1-3H3/t10-,11-,12-,15-,16+/m0/s1 |
| InChIKey | AEWOTAARLPUETJ-PVIIJVKYSA-N |
| XLogP | 4.43 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.77 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|